CAS 1379213-48-5 appears in our catalog under these names: 7-Fluoro-2,3,4,5-tetrahydro-1H-1-benzazepin-5-ol, 95%, 7-Fluoro-2,3,4,5-tetrahydro-1H-1-benzazepin-5-ol. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
7-fluoro-2,3,4,5-tetrahydro-1H-1-benzazepin-5-ol (CAS 1379213-48-5) is a chemical compound with the molecular formula C10H12FNO and a molecular weight of 181.21 g/mol. IUPAC name: 7-fluoro-2,3,4,5-tetrahydro-1H-1-benzazepin-5-ol. InChIKey: JEOGIQMESBBOQT-UHFFFAOYSA-N.
| Molecular formula | C10H12FNO |
|---|---|
| Molecular weight | 181.21 g/mol |
| IUPAC name | 7-fluoro-2,3,4,5-tetrahydro-1H-1-benzazepin-5-ol |
| InChIKey | JEOGIQMESBBOQT-UHFFFAOYSA-N |
| SMILES | C1CC(C2=C(C=CC(=C2)F)NC1)O |
Computed by PubChem (NCBI)