Products 1379296-73-7
CAS 1379296-73-7 is the registry number for Methyl 2,3-Diamino-4,5-difluorobenzoate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2,3-diamino-4,5-difluorobenzoate (CAS 1379296-73-7) is a chemical compound with the molecular formula C8H8F2N2O2 and a molecular weight of 202.16 g/mol. IUPAC name: methyl 2,3-diamino-4,5-difluorobenzoate. InChIKey: GZWQYCIGWHVNDR-UHFFFAOYSA-N.
| Molecular formula | C8H8F2N2O2 |
|---|---|
| Molecular weight | 202.16 g/mol |
| IUPAC name | methyl 2,3-diamino-4,5-difluorobenzoate |
| InChIKey | GZWQYCIGWHVNDR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1N)N)F)F |
Computed by PubChem (NCBI)