CAS 1379313-54-8 appears in our catalog under these names: 6-Bromo-5-fluoro-3,3-dimethyl-2,3-dihydro-1H-indol-2-one, 98%, 6-Bromo-5-fluoro-3,3-dimethyl-2,3-dihydro-1H-indol-2-one, 98%, 98%, 2H-Indol-2-one, 6-bromo-5-fluoro-1,3-dihydro-3,3-dimethyl-, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g, 500mg.
6-bromo-5-fluoro-3,3-dimethyl-1H-indol-2-one (CAS 1379313-54-8) is a chemical compound with the molecular formula C10H9BrFNO and a molecular weight of 258.09 g/mol. IUPAC name: 6-bromo-5-fluoro-3,3-dimethyl-1H-indol-2-one. InChIKey: SKKVJEQQZQSKQE-UHFFFAOYSA-N.
| Molecular formula | C10H9BrFNO |
|---|---|
| Molecular weight | 258.09 g/mol |
| IUPAC name | 6-bromo-5-fluoro-3,3-dimethyl-1H-indol-2-one |
| InChIKey | SKKVJEQQZQSKQE-UHFFFAOYSA-N |
| SMILES | CC1(C2=CC(=C(C=C2NC1=O)Br)F)C |
Computed by PubChem (NCBI)