Products 1379363-44-6
CAS 1379363-44-6 is the registry number for 5-Bromo-3,3,7-trimethyl-2,3-dihydro-1H-indol-2-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-bromo-3,3,7-trimethyl-1H-indol-2-one (CAS 1379363-44-6) is a chemical compound with the molecular formula C11H12BrNO and a molecular weight of 254.12 g/mol. IUPAC name: 5-bromo-3,3,7-trimethyl-1H-indol-2-one. InChIKey: UQWXOURJMWOOIM-UHFFFAOYSA-N.
| Molecular formula | C11H12BrNO |
|---|---|
| Molecular weight | 254.12 g/mol |
| IUPAC name | 5-bromo-3,3,7-trimethyl-1H-indol-2-one |
| InChIKey | UQWXOURJMWOOIM-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1NC(=O)C2(C)C)Br |
Computed by PubChem (NCBI)