CAS 1379363-96-8 appears in our catalog under these names: 5-(Ethoxycarbonyl)-1,2,3-thiadiazole-4-carboxylic acid, 97%, 97%, 5-(Ethoxycarbonyl)-1,2,3-thiadiazole-4-carboxylic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 250mg, 1g.
5-ethoxycarbonylthiadiazole-4-carboxylic acid (CAS 1379363-96-8) is a chemical compound with the molecular formula C6H6N2O4S and a molecular weight of 202.19 g/mol. IUPAC name: 5-ethoxycarbonylthiadiazole-4-carboxylic acid. InChIKey: OFAFDTVPBOVTFX-UHFFFAOYSA-N.
| Molecular formula | C6H6N2O4S |
|---|---|
| Molecular weight | 202.19 g/mol |
| IUPAC name | 5-ethoxycarbonylthiadiazole-4-carboxylic acid |
| InChIKey | OFAFDTVPBOVTFX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=NS1)C(=O)O |
Computed by PubChem (NCBI)