CAS 1379811-66-1 is the registry number for N-(2-Methoxy-5-methylphenyl)imidodicarbonimidic diamide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
1-(diaminomethylidene)-2-(2-methoxy-5-methylphenyl)guanidine (CAS 1379811-66-1) is a chemical compound with the molecular formula C10H15N5O and a molecular weight of 221.26 g/mol. IUPAC name: 1-(diaminomethylidene)-2-(2-methoxy-5-methylphenyl)guanidine. InChIKey: GJEOHZBGRMSYFD-UHFFFAOYSA-N.
| Molecular formula | C10H15N5O |
|---|---|
| Molecular weight | 221.26 g/mol |
| IUPAC name | 1-(diaminomethylidene)-2-(2-methoxy-5-methylphenyl)guanidine |
| InChIKey | GJEOHZBGRMSYFD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)OC)N=C(N)N=C(N)N |
Computed by PubChem (NCBI)