Products 76742-85-3
CAS 76742-85-3 is the registry number for Dihydrozeatin-d5. Offered by: TRC. Available pack sizes: 250mg.
1,1-dideuterio-4-(7H-purin-6-ylamino)-2-(trideuteriomethyl)butan-1-ol (CAS 76742-85-3) is a chemical compound with the molecular formula C10H15N5O and a molecular weight of 226.29 g/mol. IUPAC name: 1,1-dideuterio-4-(7H-purin-6-ylamino)-2-(trideuteriomethyl)butan-1-ol. InChIKey: XXFACTAYGKKOQB-SGEUAGPISA-N.
| Molecular formula | C10H15N5O |
|---|---|
| Molecular weight | 226.29 g/mol |
| IUPAC name | 1,1-dideuterio-4-(7H-purin-6-ylamino)-2-(trideuteriomethyl)butan-1-ol |
| InChIKey | XXFACTAYGKKOQB-SGEUAGPISA-N |
| SMILES | [2H]C([2H])([2H])C(CCNC1=NC=NC2=C1NC=N2)C([2H])([2H])O |
Computed by PubChem (NCBI)