CAS 915924-07-1 is the registry number for 2-Amino-6-isobutyl-5-methyl[1,2,4]triazolo[1,5-a]pyrimidin-7-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-amino-5-methyl-6-(2-methylpropyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one (CAS 915924-07-1) is a chemical compound with the molecular formula C10H15N5O and a molecular weight of 221.26 g/mol. IUPAC name: 2-amino-5-methyl-6-(2-methylpropyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one. InChIKey: TXHSHTZVOJNAQA-UHFFFAOYSA-N.
| Molecular formula | C10H15N5O |
|---|---|
| Molecular weight | 221.26 g/mol |
| IUPAC name | 2-amino-5-methyl-6-(2-methylpropyl)-1H-[1,2,4]triazolo[1,5-a]pyrimidin-7-one |
| InChIKey | TXHSHTZVOJNAQA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N2C(=N1)N=C(N2)N)CC(C)C |
Computed by PubChem (NCBI)