Products 2098046-87-6
CAS 2098046-87-6 is the registry number for 3-(2-Azidoethyl)-2-ethyl-2,4,6,7-tetrahydropyrano(4,3-c)pyrazole. Offered by: TRC. Available pack sizes: 500mg.
3-(2-azidoethyl)-2-ethyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole (CAS 2098046-87-6) is a chemical compound with the molecular formula C10H15N5O and a molecular weight of 221.26 g/mol. IUPAC name: 3-(2-azidoethyl)-2-ethyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole. InChIKey: IKKBPBMHHTYANH-UHFFFAOYSA-N.
| Molecular formula | C10H15N5O |
|---|---|
| Molecular weight | 221.26 g/mol |
| IUPAC name | 3-(2-azidoethyl)-2-ethyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole |
| InChIKey | IKKBPBMHHTYANH-UHFFFAOYSA-N |
| SMILES | CCN1C(=C2COCCC2=N1)CCN=[N+]=[N-] |
Computed by PubChem (NCBI)