Products 1381846-31-6
CAS 1381846-31-6 is the registry number for Methyl 5-(((tert-butoxycarbonyl)amino)methyl)-2-(difluoromethyl)benzoate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 2-(difluoromethyl)-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate (CAS 1381846-31-6) is a chemical compound with the molecular formula C15H19F2NO4 and a molecular weight of 315.31 g/mol. IUPAC name: methyl 2-(difluoromethyl)-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate. InChIKey: DFCZRCQSEDBNPI-UHFFFAOYSA-N.
| Molecular formula | C15H19F2NO4 |
|---|---|
| Molecular weight | 315.31 g/mol |
| IUPAC name | methyl 2-(difluoromethyl)-5-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoate |
| InChIKey | DFCZRCQSEDBNPI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC(=C(C=C1)C(F)F)C(=O)OC |
Computed by PubChem (NCBI)