Products 1381870-22-9

CAS 1381870-22-9 is the registry number for 2-Propylpyridin-3-ol Succinic Acid. Offered by: TRC. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Butanedioic acid;2-propylpyridin-3-ol (CAS 1381870-22-9) is a chemical compound with the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. IUPAC name: butanedioic acid;2-propylpyridin-3-ol. InChIKey: DHDYHCYMJHMKLG-UHFFFAOYSA-N.

Identity
Molecular formulaC12H17NO5
Molecular weight255.27 g/mol
IUPAC namebutanedioic acid;2-propylpyridin-3-ol
InChIKeyDHDYHCYMJHMKLG-UHFFFAOYSA-N
SMILESCCCC1=C(C=CC=N1)O.C(CC(=O)O)C(=O)O

Computed by PubChem (NCBI)