Products 1381928-28-4
CAS 1381928-28-4 appears in our catalog under these names: (2S)-2-(2-Methylphenyl)pyrrolidine hydrochloride, 97%, 97%, (S)-2-(O-Tolyl)pyrrolidine hydrochloride, 97%, (S)-2-(o-Tolyl)pyrrolidine hydrochloride, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
(2S)-2-(2-methylphenyl)pyrrolidine;hydrochloride (CAS 1381928-28-4) is a chemical compound with the molecular formula C11H16ClN and a molecular weight of 197.70 g/mol. IUPAC name: (2S)-2-(2-methylphenyl)pyrrolidine;hydrochloride. InChIKey: HNRKKCHTNWTYLS-MERQFXBCSA-N.
| Molecular formula | C11H16ClN |
|---|---|
| Molecular weight | 197.70 g/mol |
| IUPAC name | (2S)-2-(2-methylphenyl)pyrrolidine;hydrochloride |
| InChIKey | HNRKKCHTNWTYLS-MERQFXBCSA-N |
| SMILES | CC1=CC=CC=C1[C@@H]2CCCN2.Cl |
Computed by PubChem (NCBI)