CAS 1382839-19-1 appears in our catalog under these names: Vildagliptin Impurity 36, 5-Aminotricyclo(3.3.1.13,7)decane-1,3-diol. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 25mg, 50mg, 5mg.
5-aminoadamantane-1,3-diol (CAS 1382839-19-1) is a chemical compound with the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. IUPAC name: 5-aminoadamantane-1,3-diol. InChIKey: OTHKXWALZCWLGM-UHFFFAOYSA-N.
| Molecular formula | C10H17NO2 |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | 5-aminoadamantane-1,3-diol |
| InChIKey | OTHKXWALZCWLGM-UHFFFAOYSA-N |
| SMILES | C1C2CC3(CC1(CC(C2)(C3)O)N)O |
Computed by PubChem (NCBI)