Products 1383624-01-8
CAS 1383624-01-8 is the registry number for 6–chloro–2–(4–ethyl–3–nitrophenyl)imidazo(1，2–b)pyridazine. Offered by: GLPBio. Available pack sizes: 1g, 5g.
6-chloro-2-(4-ethyl-3-nitrophenyl)imidazo[1,2-b]pyridazine (CAS 1383624-01-8) is a chemical compound with the molecular formula C14H11ClN4O2 and a molecular weight of 302.71 g/mol. IUPAC name: 6-chloro-2-(4-ethyl-3-nitrophenyl)imidazo[1,2-b]pyridazine. InChIKey: XDDKCUNEMDDJMN-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN4O2 |
|---|---|
| Molecular weight | 302.71 g/mol |
| IUPAC name | 6-chloro-2-(4-ethyl-3-nitrophenyl)imidazo[1,2-b]pyridazine |
| InChIKey | XDDKCUNEMDDJMN-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=C(C=C1)C2=CN3C(=N2)C=CC(=N3)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)