Products 1383927-19-2
CAS 1383927-19-2 is the registry number for Ethyl 4-(4-chloro-1h-pyrazolo[3,4-d]pyrimidin-1-yl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 4-(4-chloropyrazolo[5,4-d]pyrimidin-1-yl)benzoate (CAS 1383927-19-2) is a chemical compound with the molecular formula C14H11ClN4O2 and a molecular weight of 302.71 g/mol. IUPAC name: ethyl 4-(4-chloropyrazolo[5,4-d]pyrimidin-1-yl)benzoate. InChIKey: VLJVVLSFEQKDIO-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN4O2 |
|---|---|
| Molecular weight | 302.71 g/mol |
| IUPAC name | ethyl 4-(4-chloropyrazolo[5,4-d]pyrimidin-1-yl)benzoate |
| InChIKey | VLJVVLSFEQKDIO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC=C(C=C1)N2C3=C(C=N2)C(=NC=N3)Cl |
Computed by PubChem (NCBI)