Products 2118-40-3
CAS 2118-40-3 appears in our catalog under these names: 2,3-Diphenyl-5-carboxytetrazolium Chloride, >96.0%(T), 2,3-Diphenyl-5-carboxytetrazolium Chloride, 96%. Offered by: TCI, Chemat. Available pack sizes: 100mg, 10mg.
2,3-diphenyltetrazol-2-ium-5-carboxylic acid chloride (CAS 2118-40-3) is a chemical compound with the molecular formula C14H11ClN4O2 and a molecular weight of 302.71 g/mol. IUPAC name: 2,3-diphenyltetrazol-2-ium-5-carboxylic acid chloride. InChIKey: FNBVGOXTOCDSJI-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN4O2 |
|---|---|
| Molecular weight | 302.71 g/mol |
| IUPAC name | 2,3-diphenyltetrazol-2-ium-5-carboxylic acid chloride |
| InChIKey | FNBVGOXTOCDSJI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2N=C(N=[N+]2C3=CC=CC=C3)C(=O)O.[Cl-] |
Computed by PubChem (NCBI)