CAS 2408588-57-6 is the registry number for N-(2-Chloropyrimidin-4-yl)-3-(4-methoxyphenyl)isoxazol-5-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-chloropyrimidin-4-yl)-3-(4-methoxyphenyl)-1,2-oxazol-5-amine (CAS 2408588-57-6) is a chemical compound with the molecular formula C14H11ClN4O2 and a molecular weight of 302.71 g/mol. IUPAC name: N-(2-chloropyrimidin-4-yl)-3-(4-methoxyphenyl)-1,2-oxazol-5-amine. InChIKey: AITRHDGVJKWKCW-UHFFFAOYSA-N.
| Molecular formula | C14H11ClN4O2 |
|---|---|
| Molecular weight | 302.71 g/mol |
| IUPAC name | N-(2-chloropyrimidin-4-yl)-3-(4-methoxyphenyl)-1,2-oxazol-5-amine |
| InChIKey | AITRHDGVJKWKCW-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NOC(=C2)NC3=NC(=NC=C3)Cl |
Computed by PubChem (NCBI)