CAS 1383777-81-8 is the registry number for 2-Chloro-7,7-dimethyl-1H,4H,6H,7H,8H-(1,3)diazino(1,2-a)pyrimidin-4-one. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-chloro-7,7-dimethyl-8,9-dihydro-6H-pyrimido[1,2-a]pyrimidin-4-one (CAS 1383777-81-8) is a chemical compound with the molecular formula C9H12ClN3O and a molecular weight of 213.66 g/mol. IUPAC name: 2-chloro-7,7-dimethyl-8,9-dihydro-6H-pyrimido[1,2-a]pyrimidin-4-one. InChIKey: XKJGJWIBHAZENY-UHFFFAOYSA-N.
| Molecular formula | C9H12ClN3O |
|---|---|
| Molecular weight | 213.66 g/mol |
| IUPAC name | 2-chloro-7,7-dimethyl-8,9-dihydro-6H-pyrimido[1,2-a]pyrimidin-4-one |
| InChIKey | XKJGJWIBHAZENY-UHFFFAOYSA-N |
| SMILES | CC1(CNC2=NC(=CC(=O)N2C1)Cl)C |
Computed by PubChem (NCBI)