CAS 1384265-56-8 is the registry number for 7-Chloro-2,3-dihydro-1-benzofuran-3-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
7-chloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 1384265-56-8) is a chemical compound with the molecular formula C8H9Cl2NO and a molecular weight of 206.07 g/mol. IUPAC name: 7-chloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: ZYALWTPSNQGZCN-UHFFFAOYSA-N.
| Molecular formula | C8H9Cl2NO |
|---|---|
| Molecular weight | 206.07 g/mol |
| IUPAC name | 7-chloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | ZYALWTPSNQGZCN-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(O1)C(=CC=C2)Cl)N.Cl |
Computed by PubChem (NCBI)