CAS 2102410-13-7 appears in our catalog under these names: (3R)-7-Chloro-2,3-dihydro-1-benzofuran-3-amine hydrochloride, 95%, (R)-7-Chloro-2,3-dihydrobenzofuran-3-amine hydrochloride, 97%, 97%, (3R)-7-CHLORO-2,3-DIHYDRO-1-BENZOFURAN-3-AMINE HYDROCHLORIDE, 97%, (R)-7-Chloro-2,3-dihydrobenzofuran-3-amine hydrochloride, 97%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
(3R)-7-chloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 2102410-13-7) is a chemical compound with the molecular formula C8H9Cl2NO and a molecular weight of 206.07 g/mol. IUPAC name: (3R)-7-chloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: ZYALWTPSNQGZCN-FJXQXJEOSA-N.
| Molecular formula | C8H9Cl2NO |
|---|---|
| Molecular weight | 206.07 g/mol |
| IUPAC name | (3R)-7-chloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | ZYALWTPSNQGZCN-FJXQXJEOSA-N |
| SMILES | C1[C@@H](C2=C(O1)C(=CC=C2)Cl)N.Cl |
Computed by PubChem (NCBI)