Products 1384268-87-4
CAS 1384268-87-4 is the registry number for (R)-3-(3-Chlorophenyl)pyrrolidine hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.
(3R)-3-(3-chlorophenyl)pyrrolidine;hydrochloride (CAS 1384268-87-4) is a chemical compound with the molecular formula C10H13Cl2N and a molecular weight of 218.12 g/mol. IUPAC name: (3R)-3-(3-chlorophenyl)pyrrolidine;hydrochloride. InChIKey: YUSUCGUNQJAOLL-FVGYRXGTSA-N.
| Molecular formula | C10H13Cl2N |
|---|---|
| Molecular weight | 218.12 g/mol |
| IUPAC name | (3R)-3-(3-chlorophenyl)pyrrolidine;hydrochloride |
| InChIKey | YUSUCGUNQJAOLL-FVGYRXGTSA-N |
| SMILES | C1CNC[C@H]1C2=CC(=CC=C2)Cl.Cl |
Computed by PubChem (NCBI)