Products 138506-45-3
CAS 138506-45-3 appears in our catalog under these names: Pidobenzone (p-Hydroxyphenyl 5-Oxo-L-Proline Ester), Pidobenzone/ 99.62% (existing batch purity), Pidobenzone, Pidobenzone, 99.65% ,, 99.65% ,. Offered by: Chemat Brand, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: on request, 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg.
(4-hydroxyphenyl) (2S)-5-oxopyrrolidine-2-carboxylate (CAS 138506-45-3) is a chemical compound with the molecular formula C11H11NO4 and a molecular weight of 221.21 g/mol. IUPAC name: (4-hydroxyphenyl) (2S)-5-oxopyrrolidine-2-carboxylate. InChIKey: SDJPNDMWNUPUFI-VIFPVBQESA-N.
| Molecular formula | C11H11NO4 |
|---|---|
| Molecular weight | 221.21 g/mol |
| IUPAC name | (4-hydroxyphenyl) (2S)-5-oxopyrrolidine-2-carboxylate |
| InChIKey | SDJPNDMWNUPUFI-VIFPVBQESA-N |
| SMILES | C1CC(=O)N[C@@H]1C(=O)OC2=CC=C(C=C2)O |
Computed by PubChem (NCBI)