CAS 138514-98-4 appears in our catalog under these names: 7-Fluoro-d-tryptophan, 95%, (R)-2-Amino-3-(7-fluoro-1H-indol-3-yl)propanoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
(2R)-2-amino-3-(7-fluoro-1H-indol-3-yl)propanoic acid (CAS 138514-98-4) is a chemical compound with the molecular formula C11H11FN2O2 and a molecular weight of 222.22 g/mol. IUPAC name: (2R)-2-amino-3-(7-fluoro-1H-indol-3-yl)propanoic acid. InChIKey: ADMHYWIKJSPIGJ-SECBINFHSA-N.
| Molecular formula | C11H11FN2O2 |
|---|---|
| Molecular weight | 222.22 g/mol |
| IUPAC name | (2R)-2-amino-3-(7-fluoro-1H-indol-3-yl)propanoic acid |
| InChIKey | ADMHYWIKJSPIGJ-SECBINFHSA-N |
| SMILES | C1=CC2=C(C(=C1)F)NC=C2C[C@H](C(=O)O)N |
Computed by PubChem (NCBI)