CAS 1385556-53-5 is the registry number for HP1-IN-2. Offered by: MedChemExpress. Available pack sizes: Get quote.
2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[(4-nitrophenyl)methyl]pyrrolidine (CAS 1385556-53-5) is a chemical compound with the molecular formula C19H20N2O4 and a molecular weight of 340.4 g/mol. IUPAC name: 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[(4-nitrophenyl)methyl]pyrrolidine. InChIKey: SCMZBBKALMQFLX-UHFFFAOYSA-N.
| Molecular formula | C19H20N2O4 |
|---|---|
| Molecular weight | 340.4 g/mol |
| IUPAC name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-1-[(4-nitrophenyl)methyl]pyrrolidine |
| InChIKey | SCMZBBKALMQFLX-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)CC2=CC=C(C=C2)[N+](=O)[O-])C3=CC4=C(C=C3)OCCO4 |
Computed by PubChem (NCBI)