CAS 1386351-29-6 is the registry number for 5-Methoxy-2,2-dimethyl-2H-chromen-6-amine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
5-methoxy-2,2-dimethylchromen-6-amine (CAS 1386351-29-6) is a chemical compound with the molecular formula C12H15NO2 and a molecular weight of 205.25 g/mol. IUPAC name: 5-methoxy-2,2-dimethylchromen-6-amine. InChIKey: MRLOUBCRQSZMNT-UHFFFAOYSA-N.
| Molecular formula | C12H15NO2 |
|---|---|
| Molecular weight | 205.25 g/mol |
| IUPAC name | 5-methoxy-2,2-dimethylchromen-6-amine |
| InChIKey | MRLOUBCRQSZMNT-UHFFFAOYSA-N |
| SMILES | CC1(C=CC2=C(O1)C=CC(=C2OC)N)C |
Computed by PubChem (NCBI)