Products 1386727-58-7
CAS 1386727-58-7 is the registry number for Methyl 3-[(tert-Butoxycarbonyl)oxy]benzoate, ≥97%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g.
Methyl 3-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoate (CAS 1386727-58-7) is a chemical compound with the molecular formula C13H16O5 and a molecular weight of 252.26 g/mol. IUPAC name: methyl 3-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoate. InChIKey: OMJPSIGSCNFNAA-UHFFFAOYSA-N.
| Molecular formula | C13H16O5 |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | methyl 3-[(2-methylpropan-2-yl)oxycarbonyloxy]benzoate |
| InChIKey | OMJPSIGSCNFNAA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)OC1=CC=CC(=C1)C(=O)OC |
Computed by PubChem (NCBI)