CAS 138704-14-0 appears in our catalog under these names: Cocaine N-Methyl-d3 (1mg/ml in Acetonitrile), Cocaine N-Methyl-d3, >95% (HPLC), Cocaine-D3, Cocaine-D3 0.1 mg/ml in Acetonitrile, Cocaine-D3 1.0 mg/ml in Acetonitrile. Offered by: TRC, Lipomed, LoGiCal, Biosynth, Sigma-Aldrich. Available pack sizes: 1x1ml, 10mg, 1mg, 50mg, 100mg, 1ml, 5mg, 25mg.
Methyl (1R,2R,3S,5S)-3-benzoyloxy-8-(trideuteriomethyl)-8-azabicyclo[3.2.1]octane-2-carboxylate (CAS 138704-14-0) is a chemical compound with the molecular formula C17H21NO4 and a molecular weight of 306.37 g/mol. IUPAC name: methyl (1R,2R,3S,5S)-3-benzoyloxy-8-(trideuteriomethyl)-8-azabicyclo[3.2.1]octane-2-carboxylate. InChIKey: ZPUCINDJVBIVPJ-MYLQKZLPSA-N.
| Molecular formula | C17H21NO4 |
|---|---|
| Molecular weight | 306.37 g/mol |
| IUPAC name | methyl (1R,2R,3S,5S)-3-benzoyloxy-8-(trideuteriomethyl)-8-azabicyclo[3.2.1]octane-2-carboxylate |
| InChIKey | ZPUCINDJVBIVPJ-MYLQKZLPSA-N |
| SMILES | [2H]C([2H])([2H])N1[C@H]2CC[C@@H]1[C@H]([C@H](C2)OC(=O)C3=CC=CC=C3)C(=O)OC |
Computed by PubChem (NCBI)