CAS 138731-14-3 appears in our catalog under these names: 2–(Ethoxycarbonyl)–1H–indole–5–carboxylic acid, 2-(Ethoxycarbonyl)-1H-indole-5-carboxylic acid, 2-(Ethoxycarbonyl)-1H-indole-5-carboxylic acid, 96%, 96%, 2-(Ethoxycarbonyl)-1H-indole-5-carboxylic acid, 97%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 2,5g, 250mg, 1g, 5g.
2-ethoxycarbonyl-1H-indole-5-carboxylic acid (CAS 138731-14-3) is a chemical compound with the molecular formula C12H11NO4 and a molecular weight of 233.22 g/mol. IUPAC name: 2-ethoxycarbonyl-1H-indole-5-carboxylic acid. InChIKey: CAVYPAYXEMVXMS-UHFFFAOYSA-N.
| Molecular formula | C12H11NO4 |
|---|---|
| Molecular weight | 233.22 g/mol |
| IUPAC name | 2-ethoxycarbonyl-1H-indole-5-carboxylic acid |
| InChIKey | CAVYPAYXEMVXMS-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(N1)C=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)