CAS 138782-45-3 is the registry number for Boc-(R)-Pga-OH. Offered by: Creative Peptides, Iris Biotech. Available pack sizes: 1g, 5g, 25g.
(3R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylbutanoic acid (CAS 138782-45-3) is a chemical compound with the molecular formula C15H21NO4 and a molecular weight of 279.33 g/mol. IUPAC name: (3R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylbutanoic acid. InChIKey: RIUSDIVWXVMDGW-LBPRGKRZSA-N.
| Molecular formula | C15H21NO4 |
|---|---|
| Molecular weight | 279.33 g/mol |
| IUPAC name | (3R)-4-[(2-methylpropan-2-yl)oxycarbonylamino]-3-phenylbutanoic acid |
| InChIKey | RIUSDIVWXVMDGW-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)NC[C@H](CC(=O)O)C1=CC=CC=C1 |
Computed by PubChem (NCBI)