CAS 1388050-44-9 is the registry number for 5-Bromo-6-fluoro-1H-1,3-benzodiazol-2-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5-bromo-6-fluoro-1H-benzimidazol-2-amine (CAS 1388050-44-9) is a chemical compound with the molecular formula C7H5BrFN3 and a molecular weight of 230.04 g/mol. IUPAC name: 5-bromo-6-fluoro-1H-benzimidazol-2-amine. InChIKey: KYGRKXWJONRITO-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFN3 |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | 5-bromo-6-fluoro-1H-benzimidazol-2-amine |
| InChIKey | KYGRKXWJONRITO-UHFFFAOYSA-N |
| SMILES | C1=C2C(=CC(=C1F)Br)N=C(N2)N |
Computed by PubChem (NCBI)