Products 2177264-81-0
CAS 2177264-81-0 appears in our catalog under these names: 8-bromo-6-fluoro-2-methyl-[1,2,4]triazolo[1,5-a]pyridine, 97%, 97%, 8-BROMO-6-FLUORO-2-METHYL-[1,2,4]TRIAZOLO[1,5-A]PYRIDINE, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
8-bromo-6-fluoro-2-methyl-[1,2,4]triazolo[1,5-a]pyridine (CAS 2177264-81-0) is a chemical compound with the molecular formula C7H5BrFN3 and a molecular weight of 230.04 g/mol. IUPAC name: 8-bromo-6-fluoro-2-methyl-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: OFHCCOJTAXEIJL-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFN3 |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | 8-bromo-6-fluoro-2-methyl-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | OFHCCOJTAXEIJL-UHFFFAOYSA-N |
| SMILES | CC1=NN2C=C(C=C(C2=N1)Br)F |
Computed by PubChem (NCBI)