CAS 1715912-67-6 appears in our catalog under these names: 4-Bromo-5-fluoro-1H-indazol-3-amine, 97%, 4-Bromo-5-fluoro-1H-indazol-3-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
4-bromo-5-fluoro-1H-indazol-3-amine (CAS 1715912-67-6) is a chemical compound with the molecular formula C7H5BrFN3 and a molecular weight of 230.04 g/mol. IUPAC name: 4-bromo-5-fluoro-1H-indazol-3-amine. InChIKey: HWROOPSJHJFFFE-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFN3 |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | 4-bromo-5-fluoro-1H-indazol-3-amine |
| InChIKey | HWROOPSJHJFFFE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1NN=C2N)Br)F |
Computed by PubChem (NCBI)