CAS 2665662-79-1 is the registry number for 7-Bromo-5-fluoro-1H-indazol-3-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
7-bromo-5-fluoro-1H-indazol-3-amine (CAS 2665662-79-1) is a chemical compound with the molecular formula C7H5BrFN3 and a molecular weight of 230.04 g/mol. IUPAC name: 7-bromo-5-fluoro-1H-indazol-3-amine. InChIKey: LEJPYITYWAOEPL-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFN3 |
|---|---|
| Molecular weight | 230.04 g/mol |
| IUPAC name | 7-bromo-5-fluoro-1H-indazol-3-amine |
| InChIKey | LEJPYITYWAOEPL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=NN2)N)Br)F |
Computed by PubChem (NCBI)