CAS 1388076-83-2 is the registry number for 5-(2-Chloro-5-methylphenyl)-1,3,4-thiadiazol-2-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2-chloro-5-methylphenyl)-1,3,4-thiadiazol-2-amine (CAS 1388076-83-2) is a chemical compound with the molecular formula C9H8ClN3S and a molecular weight of 225.70 g/mol. IUPAC name: 5-(2-chloro-5-methylphenyl)-1,3,4-thiadiazol-2-amine. InChIKey: XLISTEKUAYSNJR-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3S |
|---|---|
| Molecular weight | 225.70 g/mol |
| IUPAC name | 5-(2-chloro-5-methylphenyl)-1,3,4-thiadiazol-2-amine |
| InChIKey | XLISTEKUAYSNJR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)Cl)C2=NN=C(S2)N |
Computed by PubChem (NCBI)