CAS 575838-87-8 is the registry number for 5-(4-Chlorophenyl)-2-hydrazinylthiazole, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 250mg, 1g.
[5-(4-chlorophenyl)-1,3-thiazol-2-yl]hydrazine (CAS 575838-87-8) is a chemical compound with the molecular formula C9H8ClN3S and a molecular weight of 225.70 g/mol. IUPAC name: [5-(4-chlorophenyl)-1,3-thiazol-2-yl]hydrazine. InChIKey: VQYJRNCYRKLUMX-UHFFFAOYSA-N.
| Molecular formula | C9H8ClN3S |
|---|---|
| Molecular weight | 225.70 g/mol |
| IUPAC name | [5-(4-chlorophenyl)-1,3-thiazol-2-yl]hydrazine |
| InChIKey | VQYJRNCYRKLUMX-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=CN=C(S2)NN)Cl |
Computed by PubChem (NCBI)