Products 13895-93-7
CAS 13895-93-7 is the registry number for 8-Methoxymarmesin. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2S)-2-(2-hydroxypropan-2-yl)-9-methoxy-2,3-dihydrofuro[3,2-g]chromen-7-one (CAS 13895-93-7) is a chemical compound with the molecular formula C15H16O5 and a molecular weight of 276.28 g/mol. IUPAC name: (2S)-2-(2-hydroxypropan-2-yl)-9-methoxy-2,3-dihydrofuro[3,2-g]chromen-7-one. InChIKey: KMOMCIKYMUNSPU-JTQLQIEISA-N.
| Molecular formula | C15H16O5 |
|---|---|
| Molecular weight | 276.28 g/mol |
| IUPAC name | (2S)-2-(2-hydroxypropan-2-yl)-9-methoxy-2,3-dihydrofuro[3,2-g]chromen-7-one |
| InChIKey | KMOMCIKYMUNSPU-JTQLQIEISA-N |
| SMILES | CC(C)([C@@H]1CC2=C(O1)C(=C3C(=C2)C=CC(=O)O3)OC)O |
Computed by PubChem (NCBI)