Products 1390654-19-9

CAS 1390654-19-9 appears in our catalog under these names: 2,9-Diazaspiro[5.5]undecan-3-one dihydrochloride, 95%, 2,9-Diazaspiro(5.5)undecan-3-one dihydrochloride, 97%, 2,9–diazaspiro(5·5)undecan–3–one dihydrochloride. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.

Structural formula: {0} (CAS {1})

2,9-diazaspiro[5.5]undecan-3-one;dihydrochloride (CAS 1390654-19-9) is a chemical compound with the molecular formula C9H18Cl2N2O and a molecular weight of 241.16 g/mol. IUPAC name: 2,9-diazaspiro[5.5]undecan-3-one;dihydrochloride. InChIKey: LFGPFVGPBPQCIY-UHFFFAOYSA-N.

Identity
Molecular formulaC9H18Cl2N2O
Molecular weight241.16 g/mol
IUPAC name2,9-diazaspiro[5.5]undecan-3-one;dihydrochloride
InChIKeyLFGPFVGPBPQCIY-UHFFFAOYSA-N
SMILESC1CC2(CCNCC2)CNC1=O.Cl.Cl

Computed by PubChem (NCBI)