Products 2287310-49-8
CAS 2287310-49-8 is the registry number for 4-tert-Butylpiperazine-1-carbonyl chloride hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-tert-butylpiperazine-1-carbonyl chloride;hydrochloride (CAS 2287310-49-8) is a chemical compound with the molecular formula C9H18Cl2N2O and a molecular weight of 241.16 g/mol. IUPAC name: 4-tert-butylpiperazine-1-carbonyl chloride;hydrochloride. InChIKey: IEBSBZGIWDZXRB-UHFFFAOYSA-N.
| Molecular formula | C9H18Cl2N2O |
|---|---|
| Molecular weight | 241.16 g/mol |
| IUPAC name | 4-tert-butylpiperazine-1-carbonyl chloride;hydrochloride |
| InChIKey | IEBSBZGIWDZXRB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1CCN(CC1)C(=O)Cl.Cl |
Computed by PubChem (NCBI)