Products 1609409-15-5
CAS 1609409-15-5 appears in our catalog under these names: 2，8–diazaspiro(5·5)undecan–3–one dihydrochloride, 2,8-Diazaspiro[5.5]undecan-3-one dihydrochloride, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 1g, 5g, 10g, 250mg.
2,8-diazaspiro[5.5]undecan-3-one;dihydrochloride (CAS 1609409-15-5) is a chemical compound with the molecular formula C9H18Cl2N2O and a molecular weight of 241.16 g/mol. IUPAC name: 2,8-diazaspiro[5.5]undecan-3-one;dihydrochloride. InChIKey: HUBULIKCPAXPPM-UHFFFAOYSA-N.
| Molecular formula | C9H18Cl2N2O |
|---|---|
| Molecular weight | 241.16 g/mol |
| IUPAC name | 2,8-diazaspiro[5.5]undecan-3-one;dihydrochloride |
| InChIKey | HUBULIKCPAXPPM-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC(=O)NC2)CNC1.Cl.Cl |
Computed by PubChem (NCBI)