CAS 2514758-67-7 appears in our catalog under these names: 3-(Morpholin-4-yl)bicyclo(1.1.1)pentan-1-amine dihydrochloride, 3-Morpholinobicyclo[1.1.1]pentan-1-amine dihydrochloride, 98%, 98%. Offered by: Biosynth, Chemat. Available pack sizes: 25mg, 5g, 100mg, 250mg, 1g.
3-morpholin-4-ylbicyclo[1.1.1]pentan-1-amine;dihydrochloride (CAS 2514758-67-7) is a chemical compound with the molecular formula C9H18Cl2N2O and a molecular weight of 241.16 g/mol. IUPAC name: 3-morpholin-4-ylbicyclo[1.1.1]pentan-1-amine;dihydrochloride. InChIKey: ZXCXRKBRWMTFDK-UHFFFAOYSA-N.
| Molecular formula | C9H18Cl2N2O |
|---|---|
| Molecular weight | 241.16 g/mol |
| IUPAC name | 3-morpholin-4-ylbicyclo[1.1.1]pentan-1-amine;dihydrochloride |
| InChIKey | ZXCXRKBRWMTFDK-UHFFFAOYSA-N |
| SMILES | C1COCCN1C23CC(C2)(C3)N.Cl.Cl |
Computed by PubChem (NCBI)