CAS 1390716-50-3 is the registry number for (R)-1-(4-Chlorophenyl)-2,2-dimethylpropan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-1-(4-chlorophenyl)-2,2-dimethylpropan-1-amine (CAS 1390716-50-3) is a chemical compound with the molecular formula C11H16ClN and a molecular weight of 197.70 g/mol. IUPAC name: (1R)-1-(4-chlorophenyl)-2,2-dimethylpropan-1-amine. InChIKey: AAWIUGNSLCNMTM-JTQLQIEISA-N.
| Molecular formula | C11H16ClN |
|---|---|
| Molecular weight | 197.70 g/mol |
| IUPAC name | (1R)-1-(4-chlorophenyl)-2,2-dimethylpropan-1-amine |
| InChIKey | AAWIUGNSLCNMTM-JTQLQIEISA-N |
| SMILES | CC(C)(C)[C@H](C1=CC=C(C=C1)Cl)N |
Computed by PubChem (NCBI)