Products 139079-42-8
CAS 139079-42-8 appears in our catalog under these names: (–)–Heraclenol, Heraclenol, (-)-Heraclenol, 98.0%, (-)-Heraclenol, 98%. Offered by: GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 5mg, 25mg, 10mg, 50mg, 100mg, 1 mg, 5 mg, 10 mg.
9-[(2S)-2,3-dihydroxy-3-methylbutoxy]furo[3,2-g]chromen-7-one (CAS 139079-42-8) is a chemical compound with the molecular formula C16H16O6 and a molecular weight of 304.29 g/mol. IUPAC name: 9-[(2S)-2,3-dihydroxy-3-methylbutoxy]furo[3,2-g]chromen-7-one. InChIKey: FOINLJRVEBYARJ-NSHDSACASA-N.
| Molecular formula | C16H16O6 |
|---|---|
| Molecular weight | 304.29 g/mol |
| IUPAC name | 9-[(2S)-2,3-dihydroxy-3-methylbutoxy]furo[3,2-g]chromen-7-one |
| InChIKey | FOINLJRVEBYARJ-NSHDSACASA-N |
| SMILES | CC(C)([C@H](COC1=C2C(=CC3=C1OC=C3)C=CC(=O)O2)O)O |
Computed by PubChem (NCBI)