CAS 35345-45-0 is the registry number for (±)-Monoacetyl-cis-khellactone. Offered by: TRC. Available pack sizes: 100mg.
[(9S,10S)-9-hydroxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] acetate (CAS 35345-45-0) is a chemical compound with the molecular formula C16H16O6 and a molecular weight of 304.29 g/mol. IUPAC name: [(9S,10S)-9-hydroxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] acetate. InChIKey: IPUBQCBQSUVXEV-GJZGRUSLSA-N.
| Molecular formula | C16H16O6 |
|---|---|
| Molecular weight | 304.29 g/mol |
| IUPAC name | [(9S,10S)-9-hydroxy-8,8-dimethyl-2-oxo-9,10-dihydropyrano[2,3-f]chromen-10-yl] acetate |
| InChIKey | IPUBQCBQSUVXEV-GJZGRUSLSA-N |
| SMILES | CC(=O)O[C@@H]1[C@@H](C(OC2=C1C3=C(C=C2)C=CC(=O)O3)(C)C)O |
Computed by PubChem (NCBI)