CAS 325780-76-5 is the registry number for 1,4-Diethoxynaphthalene-2,3-dicarboxylic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
1,4-diethoxynaphthalene-2,3-dicarboxylic acid (CAS 325780-76-5) is a chemical compound with the molecular formula C16H16O6 and a molecular weight of 304.29 g/mol. IUPAC name: 1,4-diethoxynaphthalene-2,3-dicarboxylic acid. InChIKey: PZGNGPLNGCQQGU-UHFFFAOYSA-N.
| Molecular formula | C16H16O6 |
|---|---|
| Molecular weight | 304.29 g/mol |
| IUPAC name | 1,4-diethoxynaphthalene-2,3-dicarboxylic acid |
| InChIKey | PZGNGPLNGCQQGU-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=C(C2=CC=CC=C21)OCC)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)