Products 733796-13-9

CAS 733796-13-9 is the registry number for 5-(2-Ethoxy-4-formyl-phenoxymethyl)-furan-2-carboxylic acid methyl ester, 95%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 500mg.

Structural formula: {0} (CAS {1})

Methyl 5-[(2-ethoxy-4-formylphenoxy)methyl]furan-2-carboxylate (CAS 733796-13-9) is a chemical compound with the molecular formula C16H16O6 and a molecular weight of 304.29 g/mol. IUPAC name: methyl 5-[(2-ethoxy-4-formylphenoxy)methyl]furan-2-carboxylate. InChIKey: SUMHBCLAJRWJJB-UHFFFAOYSA-N.

Identity
Molecular formulaC16H16O6
Molecular weight304.29 g/mol
IUPAC namemethyl 5-[(2-ethoxy-4-formylphenoxy)methyl]furan-2-carboxylate
InChIKeySUMHBCLAJRWJJB-UHFFFAOYSA-N
SMILESCCOC1=C(C=CC(=C1)C=O)OCC2=CC=C(O2)C(=O)OC

Computed by PubChem (NCBI)