CAS 1391051-69-6 is the registry number for rac Kynurenine-13C2,15N. Offered by: TRC. Available pack sizes: 10mg.
4-(2-aminophenyl)-2-(15N)azanyl-4-oxo(1,2-13C2)butanoic acid (CAS 1391051-69-6) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 211.19 g/mol. IUPAC name: 4-(2-aminophenyl)-2-(15N)azanyl-4-oxo(1,2-13C2)butanoic acid. InChIKey: YGPSJZOEDVAXAB-SPKMFNSXSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 211.19 g/mol |
| IUPAC name | 4-(2-aminophenyl)-2-(15N)azanyl-4-oxo(1,2-13C2)butanoic acid |
| InChIKey | YGPSJZOEDVAXAB-SPKMFNSXSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C[13CH]([13C](=O)O)[15NH2])N |
Computed by PubChem (NCBI)