CAS 194546-33-3 appears in our catalog under these names: L-Kynurenine-d4, Tryptophan EP Impurity C-d4, L–Kynurenine–d4–1, L-Kynurenine-d4-1, 99.24%. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 1mg, 1 mg.
(2S)-2-amino-4-(2-amino-3,4,5,6-tetradeuteriophenyl)-4-oxobutanoic acid (CAS 194546-33-3) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 212.24 g/mol. IUPAC name: (2S)-2-amino-4-(2-amino-3,4,5,6-tetradeuteriophenyl)-4-oxobutanoic acid. InChIKey: YGPSJZOEDVAXAB-FCDGGRDXSA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | (2S)-2-amino-4-(2-amino-3,4,5,6-tetradeuteriophenyl)-4-oxobutanoic acid |
| InChIKey | YGPSJZOEDVAXAB-FCDGGRDXSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])C(=O)C[C@@H](C(=O)O)N)N)[2H])[2H] |
Computed by PubChem (NCBI)