CAS 2672568-86-2 appears in our catalog under these names: L-Kynurenine-d4 (4-(2-aminophenyl-3,5-d2), 3,3-d2), 98 atom % D, min 98% Chemical Purity, L-Kynurenine-d4 (4-(2-aminophenyl-3,5-d2), 3,3-d2), >95% (HPLC), L–Kynurenine–d4, L-Kynurenine-d4, 99.59%. Offered by: CDN, TRC, GLPBio, MedChemExpress. Available pack sizes: 0,01g, 0,005g, 10mg, 5mg, 1mg, 500μg, 5 mg, 1 mg.
(2S)-2-amino-4-(2-amino-3,5-dideuteriophenyl)-3,3-dideuterio-4-oxobutanoic acid (CAS 2672568-86-2) is a chemical compound with the molecular formula C10H12N2O3 and a molecular weight of 212.24 g/mol. IUPAC name: (2S)-2-amino-4-(2-amino-3,5-dideuteriophenyl)-3,3-dideuterio-4-oxobutanoic acid. InChIKey: YGPSJZOEDVAXAB-LVQMRTGASA-N.
| Molecular formula | C10H12N2O3 |
|---|---|
| Molecular weight | 212.24 g/mol |
| IUPAC name | (2S)-2-amino-4-(2-amino-3,5-dideuteriophenyl)-3,3-dideuterio-4-oxobutanoic acid |
| InChIKey | YGPSJZOEDVAXAB-LVQMRTGASA-N |
| SMILES | [2H]C1=CC(=C(C(=C1)C(=O)C([2H])([2H])[C@@H](C(=O)O)N)N)[2H] |
Computed by PubChem (NCBI)