CAS 1391051-92-5 is the registry number for Valdecoxib sulfonyl chloride-13C2,15N. Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
4-(5-(113C)methyl-3-phenyl-(513C,215N)1,2-oxazol-4-yl)benzenesulfonyl chloride (CAS 1391051-92-5) is a chemical compound with the molecular formula C16H12ClNO3S and a molecular weight of 336.8 g/mol. IUPAC name: 4-(5-(113C)methyl-3-phenyl-(513C,215N)1,2-oxazol-4-yl)benzenesulfonyl chloride. InChIKey: NVKQPOHDVWNXRP-LQFUBYOBSA-N.
| Molecular formula | C16H12ClNO3S |
|---|---|
| Molecular weight | 336.8 g/mol |
| IUPAC name | 4-(5-(113C)methyl-3-phenyl-(513C,215N)1,2-oxazol-4-yl)benzenesulfonyl chloride |
| InChIKey | NVKQPOHDVWNXRP-LQFUBYOBSA-N |
| SMILES | [13CH3][13C]1=C(C(=[15N]O1)C2=CC=CC=C2)C3=CC=C(C=C3)S(=O)(=O)Cl |
Computed by PubChem (NCBI)