Products 1391051-92-5

CAS 1391051-92-5 is the registry number for Valdecoxib sulfonyl chloride-13C2,15N. Offered by: Biosynth. Available pack sizes: 5mg, 10mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

4-(5-(113C)methyl-3-phenyl-(513C,215N)1,2-oxazol-4-yl)benzenesulfonyl chloride (CAS 1391051-92-5) is a chemical compound with the molecular formula C16H12ClNO3S and a molecular weight of 336.8 g/mol. IUPAC name: 4-(5-(113C)methyl-3-phenyl-(513C,215N)1,2-oxazol-4-yl)benzenesulfonyl chloride. InChIKey: NVKQPOHDVWNXRP-LQFUBYOBSA-N.

Identity
Molecular formulaC16H12ClNO3S
Molecular weight336.8 g/mol
IUPAC name4-(5-(113C)methyl-3-phenyl-(513C,215N)1,2-oxazol-4-yl)benzenesulfonyl chloride
InChIKeyNVKQPOHDVWNXRP-LQFUBYOBSA-N
SMILES[13CH3][13C]1=C(C(=[15N]O1)C2=CC=CC=C2)C3=CC=C(C=C3)S(=O)(=O)Cl

Computed by PubChem (NCBI)