Products 1391053-59-0
CAS 1391053-59-0 appears in our catalog under these names: Ropivacaine Impurity E, Ropivacaine N-Oxide (Mixture of Diastereomers), Ropivacaine Impurity 3, Ropivacaine N-Oxide, >95% (HPLC), Ropivacaine N-Oxide. Offered by: Chemat Brand, Hubei YoungXin, TRC, Biosynth. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 5mg.
(2S)-N-(2,6-dimethylphenyl)-1-oxido-1-propylpiperidin-1-ium-2-carboxamide (CAS 1391053-59-0) is a chemical compound with the molecular formula C17H26N2O2 and a molecular weight of 290.4 g/mol. IUPAC name: (2S)-N-(2,6-dimethylphenyl)-1-oxido-1-propylpiperidin-1-ium-2-carboxamide. InChIKey: RVWGBWHPDXEKHY-FUKCDUGKSA-N.
| Molecular formula | C17H26N2O2 |
|---|---|
| Molecular weight | 290.4 g/mol |
| IUPAC name | (2S)-N-(2,6-dimethylphenyl)-1-oxido-1-propylpiperidin-1-ium-2-carboxamide |
| InChIKey | RVWGBWHPDXEKHY-FUKCDUGKSA-N |
| SMILES | CCC[N+]1(CCCC[C@H]1C(=O)NC2=C(C=CC=C2C)C)[O-] |
Computed by PubChem (NCBI)